BD0433153
(R)-N-(2,6-Dimethylphenyl)-1-propylpiperidine-2-carboxamidehydrochloride , 97% , 112773-90-7
Synonym(s):
(R)-Ropivacaine hydrochloride monohydrate;(2R)-N-(2,6-Dimethylphenyl)-1-propyl-2-piperidinecarboxamide hydrochloride monohydrate;(R)-(+)-1-Propylpiperidine-2-carboxylic acid (2,6-dimethylphenyl)-amide hydrochloride monohydrate
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB256.00 | In Stock |
|
| 250mg | RMB464.00 | In Stock |
|
| 1g | RMB1160.00 | In Stock |
|
| 5g | RMB4060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Storage temp. 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Sparingly) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H26N2O.ClH/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H/t15-;/m1./s1 |
| InChIKey | NDNSIBYYUOEUSV-XFULWGLBSA-N |
| SMILES | [Cl-].N1([C@H](CCCC1)C(=O)Nc2c(cccc2C)C)CCC.[H+] |
Description and Uses
(R)-(+)-Ropivacaine Hydrochloride (Ropivacaine EP Impurity G) is a (R)-(+)-isomer of the local anesthetic Ropivacaine (R675000).
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H336-H370 |
| Precautionary statements | P260-P264-P270-P271-P304+P340+P312-P308+P311 |
| target organs | Central nervous system, Heart |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 1 |
| HS Code | 2933399090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | STOT SE 1 STOT SE 3 |
