BD0443053
(2-Hydroxyethyl)triphenylphosphoniumbromide , 96% , 7237-34-5
CAS NO.：7237-34-5
Empirical Formula: C20H20BrOP
Molecular Weight: 387.25
MDL number: MFCD00011901
EINECS: 628-593-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB80.00 | In Stock |
|
| 25g | RMB280.00 | In Stock |
|
| 100g | RMB840.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-219 °C (lit.) |
| storage temp. | 0-6°C |
| form | solid |
| Appearance | White to off-white Solid |
| Sensitive | Hygroscopic |
| BRN | 3922741 |
| InChI | InChI=1S/C20H20OP.BrH/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15,21H,16-17H2;1H/q+1;/p-1 |
| InChIKey | QZJOQNHOOVSESC-UHFFFAOYSA-M |
| SMILES | [P+](CCO)(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Br-] |
| CAS DataBase Reference | 7237-34-5(CAS DataBase Reference) |
Description and Uses
(2-Hydroxyethyl)triphenylphosphonium Bromide has cytotoxic activity against the growth of tissue culture cells originating from human epidermoid carcinoma of the nasopharynx (KB). It is commonly used as a Wittig reagent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 29310099 |
