PRODUCT Properties
| Melting point: | 170 °C (dec.)(lit.) |
| Boiling point: | 265.81°C (rough estimate) |
| Density | 1,12 g/cm3 |
| refractive index | 1.4650 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 2.49±0.24(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Beige |
| Odor | odorless |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| InChIKey | KDXKERNSBIXSRK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(CCCCN)N |
| LogP | -2.99 |
| CAS DataBase Reference | 70-54-2(CAS DataBase Reference) |
| NIST Chemistry Reference | DL-Lysine(70-54-2) |
Description and Uses
DL-Lysine is a racemic mixture of the D and L enantiomers of lysine amino acid. Used in the synthesis of proteins, alkaloids and other chemical compounds. Used as a precursor in biosynthesis of Marcfortine A.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29224110 |
