BD0461948
5-(1-(2,3-Dimethylphenyl)vinyl)-1H-imidazole , 98%mixTBCasstabilizer , 1021949-47-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB372.80 | In Stock |
|
| 250mg | RMB558.40 | In Stock |
|
| 1g | RMB1352.00 | In Stock |
|
| 5g | RMB5596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142 - 144°C |
| Boiling point: | 393.2±11.0 °C(Predicted) |
| Density | 1.066 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.68±0.10(Predicted) |
| form | Solid |
| color | Off-White to Pale Brown |
| Major Application | pharmaceutical |
| InChI | 1S/C13H14N2/c1-9-5-4-6-12(10(9)2)11(3)13-7-14-8-15-13/h4-8H,3H2,1-2H3,(H,14,15) |
| InChIKey | YJOFSWIMUJKAGV-UHFFFAOYSA-N |
| SMILES | [nH]1cncc1C(=C)c2c(c(ccc2)C)C |
Description and Uses
5-[1-(2,3-Dimethylphenyl)ethenyl]-1H-imidazole is an impurity of Dexmedetomidine (D229000), an α2-Adrenergic agonist; (+)-isomer of Medetomidine; sedative; analgesic.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H319-H361-H362 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
