BD0470932
(3R)-1-N-Cbz-3-Aminopyrrolidine , 98% , 122536-73-6
Synonym(s):
(R)-1-Benzyloxycarbonyl-3-aminopyrrolidine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB128.80 | In Stock |
|
| 5g | RMB448.80 | In Stock |
|
| 25g | RMB1524.00 | In Stock |
|
| 100g | RMB5179.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 310-316℃ |
| Boiling point: | 315 °C |
| Density | 1.155 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 9.52±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | Consistent with structure |
| Sensitive | Air Sensitive |
| InChI | 1S/C12H16N2O2/c13-11-6-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2/t11-/m1/s1 |
| InChIKey | FPXJNSKAXZNWMQ-LLVKDONJSA-N |
| SMILES | N[C@@H]1CCN(C1)C(=O)OCc2ccccc2 |
| CAS DataBase Reference | 122536-73-6(CAS DataBase Reference) |
Description and Uses
(R)-()-1-Cbz-3-aminopyrrolidine can be used:
- In one of the key synthetic steps for the preparations of AZ82, a KIFC1-specific inhibitor for cancer therapy.
- As a key intermediate in the synthesis of N6-substituted adenosine analogs as potent A1AR agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







