BD0477448
Anthracene-2-sulfonylchloride , 95+% , 17407-98-6
Synonym(s):
2-Anthracene sulfonyl chloride;2-Anthracenesulfonic acid chloride;Anthracene-2-sulfonic acid chloride
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3819.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142.5℃ |
| Boiling point: | 467.8±14.0 °C(Predicted) |
| Density | 1.424±0.06 g/cm3(Predicted) |
| solubility | acetonitrile: soluble |
| form | powder |
| BRN | 2377545 |
| InChI | 1S/C14H9ClO2S/c15-18(16,17)14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
| InChIKey | FZAQROFXYZPAKI-UHFFFAOYSA-N |
| SMILES | ClS(=O)(=O)c1ccc2cc3ccccc3cc2c1 |
Description and Uses
Derivatizing reagent with strong fluorescence.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
