BD0477548
Methyl7-(benzyloxy)-6-butyl-4-oxo-1,4-dihydroquinoline-3-carboxylate , 97% , 13997-19-8
Synonym(s):
Methyl 7-(benzyloxy)-6-butyl-1,4-dihydro-4-oxo-3-quinolinecarboxylate;Methyl benzoquate
CAS NO.：13997-19-8
Empirical Formula: C22H23NO4
Molecular Weight: 365.42
MDL number: MFCD00867198
EINECS: 237-796-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB113.60 | In Stock |
|
| 25g | RMB396.80 | In Stock |
|
| 1g | RMB2028.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 287-288° |
| Boiling point: | 520.7±50.0 °C(Predicted) |
| Density | 1.185±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acidic Methanol (Slightly, Heated, Sonicated) |
| pka | 1.06±0.70(Predicted) |
| color | White to Off-White |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C22H23NO4/c1-3-4-10-16-11-17-19(23-13-18(21(17)24)22(25)26-2)12-20(16)27-14-15-8-6-5-7-9-15/h5-9,11-13H,3-4,10,14H2,1-2H3,(H,23,24) |
| InChIKey | NNOPDLNHPOLRRE-UHFFFAOYSA-N |
| SMILES | CCCCc1cc2C(=O)C(=CNc2cc1OCc3ccccc3)C(=O)OC |
| CAS DataBase Reference | 13997-19-8(CAS DataBase Reference) |
Description and Uses
Coccidiostatic Drugs of Quinolines
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
