BD0479432
3-Fluoro-4-nitropyridine , 97% , 13505-01-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB193.60 | In Stock |
|
| 250mg | RMB293.60 | In Stock |
|
| 1g | RMB616.80 | In Stock |
|
| 5g | RMB1997.60 | In Stock |
|
| 10g | RMB3396.00 | In Stock |
|
| 25g | RMB6792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 62-64°C/5mm |
| Density | 1.439±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | liquid |
| pka | -1.11±0.18(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C5H3FN2O2/c6-4-3-7-2-1-5(4)8(9)10/h1-3H |
| InChIKey | DIFITFKCBAVEAX-UHFFFAOYSA-N |
| SMILES | C1=NC=CC([N+]([O-])=O)=C1F |
| CAS DataBase Reference | 13505-01-6(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-nitropyridine can be used as TRPC6 inhibitors for therapeutic uses.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | T,C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| HS Code | 2933399990 |
