BD0489632
1-Cyclopropyl-2-(2-fluorophenyl)ethanone , 95% , 150322-73-9
CAS NO.:150322-73-9
Empirical Formula: C11H11FO
Molecular Weight: 178.2
MDL number: MFCD10687164
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB72.80 | In Stock |
|
| 10g | RMB132.00 | In Stock |
|
| 25g | RMB252.00 | In Stock |
|
| 100g | RMB618.40 | In Stock |
|
| 500g | RMB2160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 61°C/0.2mmHg(lit.) |
| Density | 1.192±0.06 g/cm3(Predicted) |
| refractive index | 1.5150-1.5190 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Light Yellow |
| InChI | InChI=1S/C11H11FO/c12-10-4-2-1-3-9(10)7-11(13)8-5-6-8/h1-4,8H,5-7H2 |
| InChIKey | DWBGTJUQWKWYGB-UHFFFAOYSA-N |
| SMILES | C(=O)(C1CC1)CC1=CC=CC=C1F |
| CAS DataBase Reference | 150322-73-9(CAS DataBase Reference) |
Description and Uses
Prasugrel intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2933399990 |



![5,6,7,7a-Tetrahydrothieno[3,2-<i>c</i>]pyridin-2(4<i>H</i>)-one Hydrochloride](https://img.chemicalbook.com/CAS/GIF/115473-15-9.gif)



