BD0493332
(3S,4S)-4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxy-6-methylheptanoic acid , 95% , 158257-40-0
Synonym(s):
Fmoc-Sta-OH;N-Fmoc-L-statine,N-Fmoc-(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB63.20 | In Stock |
|
| 250mg | RMB109.60 | In Stock |
|
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB814.40 | In Stock |
|
| 25g | RMB2840.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94°C |
| Boiling point: | 628.2±55.0 °C(Predicted) |
| Density | 1.228±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | powder |
| pka | 4.22±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChIKey | JGUYYODGVQXZAY-SFTDATJTSA-N |
| SMILES | C(O)(=O)C[C@H](O)[C@@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC(C)C |
| CAS DataBase Reference | 158257-40-0(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 2 water endangering |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |




![Fmoc-Ala-Ser[Psi(Me,Me)Pro]-OH](https://img.chemicalbook.com/CAS/GIF/252554-78-2.gif)


