BD0500445
1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene , 98% , 140690-56-8
Synonym(s):
1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene
CAS NO.：140690-56-8
Empirical Formula: C9H5BrF6
Molecular Weight: 307.03
MDL number: MFCD00010306
EINECS: 628-148-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB800.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112°C 0,2mm |
| Density | 1.637 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 130 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| Specific Gravity | 1.637 |
| color | Clear colorless to pale yellow |
| Sensitive | Lachrymatory |
| BRN | 7995492 |
| InChI | 1S/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 |
| InChIKey | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(CBr)c(c1)C(F)(F)F |
| CAS DataBase Reference | 140690-56-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Bis(trifluoromethyl)benzyl bromide(140690-56-8) |
Description and Uses
2,4-Bis(trifluoromethyl)benzyl Bromide (CAS# 140690-56-8) can be used to cure elastomers with the use of inducers.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-27-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
