BD0504632
4-Chloro-6-methylquinoline , 98% , 18436-71-0
CAS NO.:18436-71-0
Empirical Formula: C10H8ClN
Molecular Weight: 177.63
MDL number: MFCD02684204
EINECS: 803-344-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB77.60 | In Stock |
|
| 5g | RMB276.80 | In Stock |
|
| 25g | RMB968.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51.0 to 55.0 °C |
| Boiling point: | 140°C/10mmHg(lit.) |
| Density | 1.225±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 3.79±0.16(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C10H8ClN/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3 |
| InChIKey | HZWWPOQFLMUYOX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C)=CC=2)C(Cl)=CC=1 |
Description and Uses
4-Chloro-6-methylquinoline is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








