BD0522632
8-Methylquinolin-4(1H)-one , 95% , 23432-44-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB155.20 | In Stock |
|
| 5g | RMB543.20 | In Stock |
|
| 10g | RMB923.20 | In Stock |
|
| 25g | RMB1845.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215 |
| Boiling point: | 326.8±22.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 4.47±0.40(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C10H9NO/c1-7-3-2-4-8-9(12)5-6-11-10(7)8/h2-6H,1H3,(H,11,12) |
| InChIKey | HTISUYZVEWQIMP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2C)C(O)=CC=1 |
Description and Uses
4-Hydroxy-8-methylquinoline (also commonly known as 8-hydroxy-4-methylquinoline) is an organic compound with a variety of industrial and scientific applications. Due to the proximity of the hydroxyl group (-OH) to the nitrogen atom on the heterocycle in its molecular structure, 8-hydroxyquinoline and its derivatives (including 4-methyl-8-hydroxyquinoline) are excellent multifunctional metal chelating agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |







