BD0523845
3-Fluoropropyl4-methylbenzenesulfonate , 95% , 312-68-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB106.40 | In Stock |
|
| 250mg | RMB180.00 | In Stock |
|
| 1g | RMB353.60 | In Stock |
|
| 5g | RMB1238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160 °C(Press: 2 Torr) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | clear |
| InChI | InChI=1S/C10H13FO3S/c1-9-3-5-10(6-4-9)15(12,13)14-8-2-7-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | PYCKJIAEKJWSKM-UHFFFAOYSA-N |
| SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)CCF |
Description and Uses
3-Fluoropropyl Tosylate is the tosyl protected form of 3-Fluoropropan-1-ol (F598605); a reagent used to synthesize fluorinated amino acids (e.g. DL-erythro-4-Fluoroglutamine [F591630]) and labelled N-desmethyl-loperamide analogues which have potential use as imaging radiotracers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| HS Code | 2905599890 |
