BD0526545
(2S,3R,4R,5S,6R)-6-(Hydroxymethyl)-5-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2,3,4-triol , 98%DnasefreeandRnasefree , 14641-93-1
CAS NO.:14641-93-1
Empirical Formula: C12H22O11
Molecular Weight: 342.3
MDL number: MFCD00150747
EINECS: 238-691-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB28.80 | In Stock |
|
| 25g | RMB72.80 | In Stock |
|
| 100g | RMB203.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238 °C |
| Boiling point: | 667.9±55.0 °C(Predicted) |
| Density | 1.76±0.1 g/cm3(Predicted) |
| refractive index | 52.5 ° (C=10, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Solid |
| pka | 12.02±0.70(Predicted) |
| color | White to light yellow |
| Merck | 5343 |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/s3 |
| InChIKey | GUBGYTABKSRVRQ-JGYSHAQPNA-N |
| SMILES | [C@@H]1([C@H](O)[C@H](C(O)O[C@@H]1CO)O)O[C@@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,1,3,7,12,13,15,16,18,r| |
| CAS DataBase Reference | 14641-93-1(CAS DataBase Reference) |
| EPA Substance Registry System | .alpha.-D-Glucopyranose, 4-O-.beta.-D-galactopyranosyl- (14641-93-1) |
Description and Uses
α-Lactose (α-D-Lactose) is the major sugar present in milk. Lactose exists in the form of two anomers, α and β. The α form normally crystallizes as a monohydrate[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29400090 |





