BD0536332
4-(4-Cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5(4H)-thione , 97% , 1533519-84-4
CAS NO.:1533519-84-4
Empirical Formula: C15H13N3S
Molecular Weight: 267.35
MDL number:
EINECS: 943-285-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB238.40 | In Stock |
|
| 25g | RMB852.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 435.2±38.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 7.89±0.20(Predicted) |
| Appearance | White to off-white Powder |
| InChI | InChI=1S/C15H13N3S/c19-15-17-16-9-18(15)14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7-10H,5-6H2,(H,17,19) |
| InChIKey | UFYFJMMSOUURSF-UHFFFAOYSA-N |
| SMILES | N1=CN(C2=C3C(C=CC=C3)=C(C3CC3)C=C2)C(=S)N1 |
| CAS DataBase Reference | 1533519-84-4 |
Description and Uses
4-(4-Cyclopropylnaphthalen-1-yl)-1H-1,2,4-triazole-5(4H)-thione is a reagent used in the discovery of Lesinurad, a HEK293 cell-based inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |






