BD0546232
Boc-Gly-OMe , 97% , 31954-27-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB44.80 | In Stock |
|
| 25g | RMB64.00 | In Stock |
|
| 100g | RMB232.00 | In Stock |
|
| 500g | RMB1015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190 °C(lit.) |
| Density | 1.28 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.437(lit.) |
| Flash point: | 109 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| pka | 11.06±0.46(Predicted) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-7(11)9-5-6(10)12-4/h5H2,1-4H3,(H,9,11) |
| InChIKey | PHUZOEOLWIHIKH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CNC(OC(C)(C)C)=O |
Description and Uses
It is used as a pharmaceutical, chemical, paint and dye intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
