BD0546832
2-Methylnicotinic acid , 98% , 3222-56-8
Synonym(s):
2-Methylnicotinic acid;2-Methylpyridine-3-carboxylic acid
CAS NO.：3222-56-8
Empirical Formula: C7H7NO2
Molecular Weight: 137.14
MDL number: MFCD00013449
EINECS: 628-913-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.00 | In Stock |
|
| 5g | RMB164.00 | In Stock |
|
| 10g | RMB272.00 | In Stock |
|
| 25g | RMB552.00 | In Stock |
|
| 100g | RMB2088.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C (dec.)(lit.) |
| Boiling point: | 280.4±20.0 °C(Predicted) |
| Density | 1.230±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.95±0.10(Predicted) |
| form | Powder or Crystalline |
| color | Off-white to light brown |
| BRN | 114333 |
| InChI | InChI=1S/C7H7NO2/c1-5-6(7(9)10)3-2-4-8-5/h2-4H,1H3,(H,9,10) |
| InChIKey | HNTZKNJGAFJMHQ-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1C(O)=O |
| CAS DataBase Reference | 3222-56-8(CAS DataBase Reference) |
Description and Uses
2-Methylpyridine-3-carboxylic acid was used in synthesis of 1,8-dioxo-1,2,7,8-tetrahydro-2,7,10-triaza-anthracene-4,5-dicarbaldehydes (DOTTADs) and their imines. It was also used in synthesis of 7,7-dichloro-5,7-dihydro-thieno[3,4-b]pyridin-5-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
