![(1R,4R)-tert-Butyl2,5-diazabicyclo[2.2.1]heptane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/134003-84-2.gif)
BD0546845
(1R,4R)-tert-Butyl2,5-diazabicyclo[2.2.1]heptane-2-carboxylate , 95% , 134003-84-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB118.40 | In Stock |
|
| 250mg | RMB220.00 | In Stock |
|
| 1g | RMB676.00 | In Stock |
|
| 5g | RMB2906.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 276.4±15.0 °C(Predicted) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.74±0.20(Predicted) |
| form | solid |
| color | White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-6-7-4-8(12)5-11-7/h7-8,11H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | UXAWXZDXVOYLII-HTQZYQBOSA-N |
| SMILES | [C@@]12([H])C[C@@]([H])(NC1)CN2C(OC(C)(C)C)=O |
Description and Uses
(1R,4R)-5-Boc-2,5-diazabicyclo[2.2.1]heptane is a useful reagent employed in the preparation of tetrahydroisoquinolines as CXCR4 antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
