BD0550753
Ethyl2-propylpentanoate , 95% , 17022-31-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB104.80 | In Stock |
|
| 1g | RMB268.00 | In Stock |
|
| 5g | RMB968.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 104 °C(Press: 32 Torr) |
| Density | 0.859 g/cm3(Temp: 24 °C) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C10H20O2/c1-4-7-9(8-5-2)10(11)12-6-3/h9H,4-8H2,1-3H3 |
| InChIKey | WIKWUBHEBLFWHH-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(CCC)CCC |
Description and Uses
Valproic Acid Ethyl Ester is the ethyl ester derivative of one of the major antiepileptic drugs, Valproic Acid (V094750). It has potential to be used as a biofuel, has a pleasant odor, and displays marked resistance to clouding and crystallization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| WGK Germany | WGK 2 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |
