BD0557153
6,6''-Dibromo-2,2':6',2''-terpyridine , 98% , 100366-66-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB257.60 | In Stock |
|
| 250mg | RMB381.60 | In Stock |
|
| 1g | RMB1427.20 | In Stock |
|
| 5g | RMB5566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 257-263 °C(lit.) |
| Boiling point: | 473.0±40.0 °C(Predicted) |
| Density | 1.685±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| pka | 0.17±0.41(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | 1S/C15H9Br2N3/c16-14-8-2-6-12(19-14)10-4-1-5-11(18-10)13-7-3-9-15(17)20-13/h1-9H |
| InChIKey | PYMBATDYUCQLBC-UHFFFAOYSA-N |
| SMILES | Brc1cccc(n1)-c2cccc(n2)-c3cccc(Br)n3 |
Description and Uses
6,6′′-Dibromo-2,2′:6′,2′′-terpyridine may be used in the synthesis of a novel disubstituted terpyridine ligand.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
