BD0570932
3-Chloro-4-nitroaniline , 97% , 825-41-2
CAS NO.：825-41-2
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00085922
EINECS: 642-644-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB80.80 | In Stock |
|
| 10g | RMB152.80 | In Stock |
|
| 25g | RMB314.40 | In Stock |
|
| 100g | RMB1226.40 | In Stock |
|
| 500g | RMB6046.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158°C |
| Boiling point: | 366.8±22.0 °C(Predicted) |
| Density | 1.494 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -0.06±0.10(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Insoluble in water. |
| λmax | 350nm(Dioxane)(lit.) |
| InChI | InChI=1S/C6H5ClN2O2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H,8H2 |
| InChIKey | LDSIOPGMLLPSSR-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C([N+]([O-])=O)C(Cl)=C1 |
| CAS DataBase Reference | 825-41-2(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-nitroaniline is used as a pharmaceutical and medical intermediate.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H315-H319-H332 |
| Precautionary statements | P280h-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi |
| RIDADR | UN 2237 6.1/PG III |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
