BD0573932
1,3-Dimethylpiperidin-4-one , 97% , 4629-80-5
CAS NO.：4629-80-5
Empirical Formula: C7H13NO
Molecular Weight: 127.18
MDL number: MFCD00100893
EINECS: 225-046-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB40.80 | In Stock |
|
| 10g | RMB78.40 | In Stock |
|
| 25g | RMB152.80 | In Stock |
|
| 100g | RMB584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 62°C/12mmHg(lit.) |
| Density | 0.950 |
| refractive index | 1.4580 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 8.06±0.40(Predicted) |
| color | Clear Light Yellow |
| InChI | InChI=1S/C7H13NO/c1-6-5-8(2)4-3-7(6)9/h6H,3-5H2,1-2H3 |
| InChIKey | BGDGMIWDPMJYPP-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(=O)C(C)C1 |
| CAS DataBase Reference | 4629-80-5(CAS DataBase Reference) |
Description and Uses
1,3-Dimethylpiperidin-4-one is a key intermediate used in the preparation of Alvimopan, an Opiod drug.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-43 |
| Safety Statements | 26-36/37-39 |
| HS Code | 2933399990 |
