BD0584053
2-Methoxy-N,N-dimethylacetamide , 97% , 4128-76-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB77.60 | In Stock |
|
| 5g | RMB272.00 | In Stock |
|
| 25g | RMB834.40 | In Stock |
|
| 100g | RMB3279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 93-94 °C(Press: 15 Torr) |
| Density | 0.961±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -0.77±0.70(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5H11NO2/c1-6(2)5(7)4-8-3/h4H2,1-3H3 |
| InChIKey | DZLUPKIRNOCKJB-UHFFFAOYSA-N |
| SMILES | C(N(C)C)(=O)COC |
Description and Uses
2-Methoxy-N,N-dimethylacetamide is a useful compound for technical use in power storage devices, capacitors, and lithium ion batteries.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
