BD0589248
Bis(ethylcyclopentadienyl)ruthenium(II) , 98% , 32992-96-4
Synonym(s):
Diethylruthenocene;Ru(EtCp)2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB6640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6 °C (lit.) |
| Boiling point: | 100 °C/0.01 mmHg (lit.) |
| Density | 1.3412 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >200 °F |
| storage temp. | -20°C |
| form | liquid |
| color | pale yellow |
| Specific Gravity | 1.341 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C7H5.Ru/c2*1-2-7-5-3-4-6-7;/h2*2H2,1H3;/q2*-1;+2 |
| InChIKey | HXJQELBDFQFTHS-UHFFFAOYSA-N |
| SMILES | C([C-]12C3=C4C5=C1[Ru+2]16782345C2C1=C6[C-]7(CC)C8=2)C |
Description and Uses
Bis(ethylcyclopentadienyl)ruthenium(II) (Ru(EtCp)2), a metal organic is used as an atomic layer deposition precursor for Ru thin filmsand well-aligned RuO2 nanorods.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 14/15-36/37/38 |
| Safety Statements | 26-43 |
| RIDADR | UN 3398 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






