BD0594032
4-Methyl-3-nitropyridine , 97% , 5832-44-0
CAS NO.：5832-44-0
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00051829
EINECS: 628-685-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB56.00 | In Stock |
|
| 5g | RMB168.00 | In Stock |
|
| 10g | RMB293.60 | In Stock |
|
| 25g | RMB673.60 | In Stock |
|
| 100g | RMB2013.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24-28 °C |
| Boiling point: | 238 °C |
| Density | 1.228 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 227 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.87±0.18(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| BRN | 118796 |
| InChI | InChI=1S/C6H6N2O2/c1-5-2-3-7-4-6(5)8(9)10/h2-4H,1H3 |
| InChIKey | JLNRJMGYBKMDGI-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 5832-44-0(CAS DataBase Reference) |
Description and Uses
4-Methyl-3-nitropyridine may be used as a starting material in the synthesis of ethyl 6-azaindole-2-carboxylate and also 3-substituted azaindoles.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
