BD0595632
(R)-2-Amino-3-cyclohexylpropanoic acid , 95% , 58717-02-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB78.40 | In Stock |
|
| 10g | RMB143.20 | In Stock |
|
| 25g | RMB290.40 | In Stock |
|
| 100g | RMB1141.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 307.1±25.0 °C(Predicted) |
| Density | 1.075 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 2.33±0.10(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 12±1°, c = 1% in 1 M HCl (dry matter) |
| BRN | 3197315 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C9H17NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h7-8H,1-6,10H2,(H,11,12)/t8-/s3 |
| InChIKey | ORQXBVXKBGUSBA-MRVPVSSYSA-N |
| SMILES | C1(CCCCC1)C[C@@H](N)C(=O)O |&1:7,r| |
| CAS DataBase Reference | 58717-02-5(CAS DataBase Reference) |
Description and Uses
(R)-2-amino-3-cyclohexylpropanoic acid is an alanine derivative[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 13 - Non Combustible Solids |







