BD0604445
Fmoc-Ala-Thr(Psi(Me,Me)pro)-OH , 95% , 252554-79-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.00 | In Stock |
|
| 1g | RMB270.40 | In Stock |
|
| 5g | RMB1248.80 | In Stock |
|
| 10g | RMB2441.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 681.2±55.0 °C(Predicted) |
| Density | 1.259±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.15±0.60(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChIKey | GBTYMCWKCJUKDT-ZSDSOXJFSA-N |
| SMILES | O1[C@H](C)[C@@H](C(O)=O)N(C(=O)[C@@H](NC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C)C1(C)C |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 2 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |







