BD0606345
Ethyl4-acetamidobenzoate , 98% , 5338-44-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB104.00 | In Stock |
|
| 1g | RMB300.80 | In Stock |
|
| 5g | RMB968.80 | In Stock |
|
| 10g | RMB1832.80 | In Stock |
|
| 25g | RMB3690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181 °C |
| Boiling point: | 390.8±25.0 °C(Predicted) |
| Density | 1.171±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | Solid |
| pka | 14.59±0.70(Predicted) |
| color | White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C11H13NO3/c1-3-15-11(14)9-4-6-10(7-5-9)12-8(2)13/h4-7H,3H2,1-2H3,(H,12,13) |
| InChIKey | NHLOBHNRBWKNIO-UHFFFAOYSA-N |
| SMILES | N(c1ccc(cc1)C(=O)OCC)C(=O)C |
Description and Uses
Ethyl 4-acetamidobenzoate is a reagent that is used in the synthesis of DAMPA-d3, which is a labeleld antitumor agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P337+P313-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
