BD0636853
6-Chlorobenzo[d]oxazole-2(3H)-thione , 98% , 22876-20-6
CAS NO.:22876-20-6
Empirical Formula: C7H4ClNOS
Molecular Weight: 185.63
MDL number: MFCD00800495
EINECS: 245-282-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB269.60 | In Stock |
|
| 25g | RMB799.20 | In Stock |
|
| 100g | RMB3056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-232 °C |
| Boiling point: | 288.9±42.0 °C(Predicted) |
| Density | 1.2291 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | Crystalline Powder or Needles |
| pka | 10.23±0.20(Predicted) |
| color | Yellow to beige |
| InChI | InChI=1S/C7H4ClNOS/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H,9,11) |
| InChIKey | HAASPZUBSZGCKU-UHFFFAOYSA-N |
| SMILES | O1C2=CC(Cl)=CC=C2NC1=S |
Description and Uses
6-Chloro-2(3H)-benzoxazolethione is used as a reactant in the synthesis of disulfide bond-containing ajoene analogs as quorum sensing inhibitors.

![6-Chlorobenzo[d]oxazole-2(3H)-thione](https://img.chemicalbook.com/CAS/GIF/22876-20-6.gif)



