BD0637353
Perfluorophenyltrifluoromethanesulfonate , 97% , 60129-85-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB100.80 | In Stock |
|
| 250mg | RMB152.80 | In Stock |
|
| 1g | RMB390.40 | In Stock |
|
| 5g | RMB1103.20 | In Stock |
|
| 25g | RMB3177.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 40°C/0.5mmHg(lit.) |
| Density | 1.75 |
| refractive index | 1.3880 to 1.3920 |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7F8O3S/c8-1-2(9)4(11)6(5(12)3(1)10)18-19(16,17)7(13,14)15 |
| InChIKey | OTTBRWDUQHDNBY-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2905190098 |
