BD0639632
6-Methyl-3-nitropyridin-2-ol , 95% , 39745-39-6
Synonym(s):
6-Hydroxy-5-nitro-2-picoline
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB92.80 | In Stock |
|
| 10g | RMB178.40 | In Stock |
|
| 25g | RMB364.00 | In Stock |
|
| 100g | RMB1393.60 | In Stock |
|
| 500g | RMB6753.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-226 C |
| Boiling point: | 277.46°C (rough estimate) |
| Density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.47±0.10(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | 1S/C6H6N2O3/c1-4-2-3-5(8(10)11)6(9)7-4/h2-3H,1H3,(H,7,9) |
| InChIKey | YVYDGIGILRUPED-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(O)n1)[N+]([O-])=O |
| CAS DataBase Reference | 39745-39-6(CAS DataBase Reference) |
Description and Uses
2-Hydroxy-6-methyl-3-nitropyridine is a water soluble compound that has been used for the treatment of tuberculosis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 37/39-26-36-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








