BD0642945
2-(3,4-Dimethoxyphenyl)-3-methylbutanenitrile , 95% , 20850-49-1
CAS NO.：20850-49-1
Empirical Formula: C13H17NO2
Molecular Weight: 219.28
MDL number: MFCD00800230
EINECS: 244-082-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB92.00 | In Stock |
|
| 1g | RMB224.00 | In Stock |
|
| 5g | RMB784.00 | In Stock |
|
| 25g | RMB2665.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49°C |
| Boiling point: | 160-166 °C(Press: 6 Torr) |
| Density | 1.023±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Major Application | pharmaceutical |
| InChI | 1S/C13H17NO2/c1-9(2)11(8-14)10-5-6-12(15-3)13(7-10)16-4/h5-7,9,11H,1-4H3 |
| InChIKey | NFXAXMOAVPLEBH-UHFFFAOYSA-N |
| SMILES | N#CC(C(C)C)c1cc(c(cc1)OC)OC |
| CAS DataBase Reference | 20850-49-1(CAS DataBase Reference) |
Description and Uses
(Verapamil EP Impurity K)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
