BD0645845
Bicyclo[3.2.0]hept-2-en-6-one , 95% , 13173-09-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.00 | In Stock |
|
| 1g | RMB193.60 | In Stock |
|
| 5g | RMB602.40 | In Stock |
|
| 10g | RMB948.80 | In Stock |
|
| 25g | RMB1853.60 | In Stock |
|
| 100g | RMB5584.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158-160 °C(lit.) |
| Density | 1.025 g/mL at 25 °C(lit.) |
| refractive index | n |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H8O/c8-7-4-5-2-1-3-6(5)7/h1-2,5-6H,3-4H2 |
| InChIKey | LNLLHUHPGPKRBM-UHFFFAOYSA-N |
| SMILES | C12C(C(=O)C1)CC=C2 |
Description and Uses
Bicyclo[3.2.0]hept-2-en-6-one is widely utilized to study enantioselective Baeyer-Villiger oxidation of (±)-cis-bicyclo(3.2.0)hept-2-en-6-one. It is used in the synthesis of a series of chalcone derivatives by reacting with arylaldehydes. It is also used to analyze the extremophile enzymes (monooxygenase and hydrolases) in microorganisms which are isolated from a deep-water petroleum reservoir and at high temperatures using fluorogenic assays and multibioreactions.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN1224 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

![Bicyclo[3.2.0]hept-2-en-6-one](https://img.chemicalbook.com/CAS/GIF/13173-09-6.gif)


![(3AS,4R,5S,6AR)-5-(BENZOYLOXY)HEXAHYDRO-4-(HYDROXYMETHYL)-2H-CYCLOPENTA[B]FURAN-2-ONE](https://img.chemicalbook.com/CAS/GIF/53275-53-9.gif)
![3,3A,6,6A-TETRAHYDROCYCLOPENTA[B]FURAN-2-ONE](https://img.chemicalbook.com/CAS/GIF/34638-25-0.gif)
![3-(2-CHLORO-4-METHYLBENZOYL)-4-PHENYLTHIOBICYCLO[3,2,1]OCT-2-EN-4-ONE](https://img.chemicalbook.com/CAS/GIF/156963-66-5.gif)

