BD0646845
tert-Butyl3-aminobenzoate , 97% , 92146-82-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB82.40 | In Stock |
|
| 5g | RMB319.20 | In Stock |
|
| 25g | RMB1132.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C |
| Boiling point: | 309.2±15.0 °C(Predicted) |
| Density | 1.078±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder or crystals |
| pka | 3.44±0.10(Predicted) |
| color | white to light beige |
| BRN | 2717992 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H15NO2/c1-11(2,3)14-10(13)8-5-4-6-9(12)7-8/h4-7H,12H2,1-3H3 |
| InChIKey | YGIRNXMYJLWFLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cccc(N)c1 |
| CAS DataBase Reference | 92146-82-2(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
