BD0647532
1-(2-Amino-4-methoxy-3-methylphenyl)ethanone , 97% , 912347-94-5
CAS NO.：912347-94-5
Empirical Formula: C10H13NO2
Molecular Weight: 179.22
MDL number: MFCD11042290
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.80 | In Stock |
|
| 1g | RMB219.20 | In Stock |
|
| 5g | RMB729.60 | In Stock |
|
| 25g | RMB2866.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107 °C |
| Boiling point: | 336.0±37.0 °C(Predicted) |
| Density | 1.096±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 1.74±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C10H13NO2/c1-6-9(13-3)5-4-8(7(2)12)10(6)11/h4-5H,11H2,1-3H3 |
| InChIKey | VXBGCEDOGYNWHE-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C(C)=C1N)C |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2922500090 |
