BD0654632
                    3-Vinylbicyclo[4.2.0]octa-1,3,5-triene , 97% , 99717-87-0
                            Synonym(s):
3-Ethenyl(bicyclo[4.2.0]-octa-1,3,5-triene);VBCB
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 100mg | RMB64.80 | In Stock | 
                                                 | 
                                        
| 250mg | RMB132.00 | In Stock | 
                                                 | 
                                        
| 1g | RMB367.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB1603.20 | In Stock | 
                                                 | 
                                        
| 10g | RMB3084.00 | In Stock | 
                                                 | 
                                        
| 25g | RMB6384.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 225.3±30.0 °C(Predicted) | 
                                    
| Density | 0.962 g/mL at 25 °C | 
                                    
| refractive index | n20/D1.578 | 
                                    
| Flash point: | 76℃ | 
                                    
| storage temp. | 2-8°C | 
                                    
| form | liquid | 
                                    
| Appearance | Colorless to light yellow Liquid | 
                                    
| InChI | InChI=1S/C10H10/c1-2-8-3-4-9-5-6-10(9)7-8/h2-4,7H,1,5-6H2 | 
                                    
| InChIKey | UIJKVOGFQPSFQN-UHFFFAOYSA-N | 
                                    
| SMILES | C12C(CC1)=CC=C(C=C)C=2 | 
                                    
| CAS DataBase Reference | 99717-87-0 | 
                                    
Description and Uses
4-Vinylbenzocyclobutene is a reagent used in the process of improving the mechanical properties of carbon nanotube fibers through crosslinking.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H227-H302-H412 | 
| Precautionary statements | P210-P270-P273 | 
| Hazard Codes | Xn | 
| Risk Statements | 22 | 
| RIDADR | NA 1993 / PGIII | 
| WGK Germany | 1 | 

![3-Vinylbicyclo[4.2.0]octa-1,3,5-triene](https://img.chemicalbook.com/CAS/GIF/99717-87-0.gif)


![4-[2-(Triethoxysilyl)vinyl]benzocyclobutene](https://img.chemicalbook.com/CAS/GIF/124389-79-3.gif)
![Bicyclo[4.2.0]octa-1,3,5-triene-3-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/875-94-5.gif)
![4-bromobicyclo[4.2.0]octa-1(6),2,4-triene](https://img.chemicalbook.com/CAS/GIF/1073-39-8.gif)
