BD0669353
1-(4-Nitrophenyl)piperazine , 96% , 6269-89-2
CAS NO.：6269-89-2
Empirical Formula: C10H13N3O2
Molecular Weight: 207.23
MDL number: MFCD00005961
EINECS: 228-443-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25g | RMB121.60 | In Stock |
|
| 100g | RMB484.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C (lit.) |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1933 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| form | Crystalline Powder, Crystals and/or Chunks |
| pka | 8.68±0.10(Predicted) |
| color | White to beige to gray |
| InChI | InChI=1S/C10H13N3O2/c14-13(15)10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| InChIKey | VWOJSRICSKDKAW-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C([N+]([O-])=O)C=C2)CCNCC1 |
| CAS DataBase Reference | 6269-89-2(CAS DataBase Reference) |
| NIST Chemistry Reference | N-p-nitrophenylpiperazine(6269-89-2) |
Description and Uses
1-(4-Nitrophenyl)piperazine is a useful synthetic intermediate in the synthesis of Itraconazole (I937500); an orally active antimycotic structurally related to Ketoconazole. Also antifungal.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-24/25-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
