BD0669753
(2R,3S,4S)-5-(7,8-Dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentane-1,2,3,4-tetrayltetrabutyrate , 98% , 752-56-7
CAS NO.:752-56-7
Empirical Formula: C33H44N4O10
Molecular Weight: 656.72
MDL number: MFCD32644640
EINECS: 212-034-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5g | RMB126.40 | In Stock |
|
| 25g | RMB404.00 | In Stock |
|
| 100g | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149 °C |
| Density | 1.250 g/cm3 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 9.83±0.70(Predicted) |
| color | Yellow |
| Merck | 14,8200 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | MJNIWUJSIGSWKK-FSGGQHMVSA-N |
| SMILES | CC1C(C)=CC2N=C3C(=NC(=O)NC3=O)N(C[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)COC(=O)CCC)C=2C=1 |
Description and Uses
Riboflavin Tetrabutyrate is a lipophilic flavin derivative with antioxidative and lipid peroxide-removing activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| RTECS | VJ1755000 |
| HS Code | 2934.99.4400 |

![(2R,3S,4S)-5-(7,8-Dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentane-1,2,3,4-tetrayltetrabutyrate](https://img.chemicalbook.com/CAS/GIF/752-56-7.gif)



![7,8,10-Trimethylbenzo[g]pteridine-2,4(3H,10H)-dione](https://img.chemicalbook.com/CAS/GIF/1088-56-8.gif)
