BD0673853
Gadolinium(iii)acetatexhydrate , 99.99% , 100587-93-7
CAS NO.:100587-93-7
Empirical Formula: C6H11GdO7
Molecular Weight: 352.4
MDL number: MFCD00150116
EINECS: 629-563-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25g | RMB35.20 | In Stock |
|
| 100g | RMB97.60 | In Stock |
|
| 500g | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.611 |
| form | Crystals |
| Specific Gravity | 1.611 |
| color | White |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| InChI | 1S/3C2H4O2.Gd.H2O/c3*1-2(3)4;;/h3*1H3,(H,3,4);;1H2/q;;;+3;/p-3 |
| InChIKey | GXCUBNRUECGTSC-UHFFFAOYSA-K |
| SMILES | O.CC(=O)O[Gd](OC(C)=O)OC(C)=O |
Description and Uses
Gadolinium(III) acetate hydrate is used as a laboratory reagent, catalysts, optical glasses, structural ceramics, electrical components and photo-optical material.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






