BD0678953
Trimethylsilyltrifluoroacetate , 95%GC , 400-53-3
Synonym(s):
Trifluoroacetic acid trimethylsilyl ester
CAS NO.：400-53-3
Empirical Formula: C5H9F3O2Si
Molecular Weight: 186.2
MDL number: MFCD00000413
EINECS: 206-923-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB39.20 | In Stock |
|
| 25g | RMB164.80 | In Stock |
|
| 100g | RMB628.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 88-90 °C(lit.) |
| Density | 1.078 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point: | °C |
| storage temp. | Flammables area |
| form | Powder |
| color | White |
| Specific Gravity | 1.078 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1773314 |
| InChI | InChI=1S/C5H9F3O2Si/c1-11(2,3)10-4(9)5(6,7)8/h1-3H3 |
| InChIKey | VIYXXANHGYSBLY-UHFFFAOYSA-N |
| SMILES | C(O[Si](C)(C)C)(=O)C(F)(F)F |
| CAS DataBase Reference | 400-53-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, trifluoro-, trimethylsilyl ester (400-53-3) |
Description and Uses
Trimethysilyl Trifluoroacetate is a useful research chemical used as a promotor for stereoselective addition of silyl azides to meso epoxides.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-34-37 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable |
| TSCA | Yes |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29319019 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
