BD0690632
Fmoc-Gly-Gly-Gly-OH , 97% , 170941-79-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1g | RMB64.80 | In Stock |
|
| 5g | RMB237.60 | In Stock |
|
| 10g | RMB419.20 | In Stock |
|
| 25g | RMB1022.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 811.8±65.0 °C(Predicted) |
| Density | 1.354±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder or crystals |
| pka | 3.33±0.10(Predicted) |
| color | white to off-white |
| SMILES | O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NCC(=O)NCC(=O)NCC(=O)O |
Description and Uses
Fmoc-Gly-Gly-Gly-OH is a tripeptide that can be used in peptide synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |



![Ethyl 4-(1-methyl-5-nitro-1H-benzo[d]imidazol-2-yl)butanoate](https://img.chemicalbook.com/CAS/GIF/3543-72-4.gif)
![Ethyl 4-(5-amino-1-methyl-1H-benzo[d]imidazol-2-yl)butanoate](https://img.chemicalbook.com/CAS/GIF/3543-73-5.gif)
![Ethyl 4-(5-(bis(2-hydroxyethyl)amino)-1-methyl-1H-benzo[d]imidazol-2-yl)butanoate](https://img.chemicalbook.com/CAS/GIF/3543-74-6.gif)
![(2AR,2''R,4S,5''R,6aR,6bS,8aS,8bR,9S,11aS,12aS,12bS)-2a,4-dihydroxy-5'',6a,8a,9-tetramethylicosahydrospiro[naphtho[2'',1'':4,5]indeno[2,1-b]furan-10,2''-pyran]-2(11aH)-one](https://img.chemicalbook.com/CAS/GIF/56786-63-1.gif)
