BD0693345
2-Chlorobenzoylacetonitrile , 98% , 40018-25-5
CAS NO.：40018-25-5
Empirical Formula: C9H6ClNO
Molecular Weight: 179.6
MDL number: MFCD00051624
EINECS: 609-772-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB88.00 | In Stock |
|
| 25g | RMB274.40 | In Stock |
|
| 100g | RMB711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 302.2±22.0 °C(Predicted) |
| Density | 1.2364 (rough estimate) |
| refractive index | 1.5330 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.41±0.10(Predicted) |
| color | Yellow to Dark Yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2413204 |
| InChI | InChI=1S/C9H6ClNO/c10-8-4-2-1-3-7(8)9(12)5-6-11/h1-4H,5H2 |
| InChIKey | SBSWHTFHLWSSQS-UHFFFAOYSA-N |
| SMILES | C1(C=CC=CC=1Cl)C(=O)CC#N |
| LogP | 0.8 at 30℃ |
| CAS DataBase Reference | 40018-25-5(CAS DataBase Reference) |
Description and Uses
2-Chlorobenzoylacetonitrile is used in the synthesis of Clotiazepam (C587410). Compound commonly found in brown and black hair dyes.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H301-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22 |
| RIDADR | 3276 |
| PackingGroup | III |
| HS Code | 29269095 |
