BD0697732
3-(Dimethylamino)-1-(naphthalen-1-yl)propan-1-one , 97% , 10320-49-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB176.00 | In Stock |
|
| 1g | RMB347.20 | In Stock |
|
| 5g | RMB1180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 368.7±25.0 °C(Predicted) |
| Density | 1.072 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 8.78±0.28(Predicted) |
| Appearance | Colorless to light yellow Viscous liquid |
| InChI | InChI=1S/C15H17NO/c1-16(2)11-10-15(17)14-9-5-7-12-6-3-4-8-13(12)14/h3-9H,10-11H2,1-2H3 |
| InChIKey | CXDXSNWZXJVDMC-UHFFFAOYSA-N |
| SMILES | C(C1=C2C(C=CC=C2)=CC=C1)(=O)CCN(C)C |
Description and Uses
3-(Dimethylamino)-1-(1-Naphthalenyl)-1-Propanone is a compound related to TMC207 which is used in the treatment of drug-resistant tuberculosis, and was studied for its anti-tubercular activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







