BD0708432
3-Hydroxy-2-phenylpropanoic acid , 98% , 552-63-6
Synonym(s):
Tropic acid;Tropicamide Related Compound C;2-Phenylhydracrylic acid;3-Hydroxy-2-phenylpropionic acid;3-Hydroxy-2-phenylpropionic acid, α-Phenylhydracrylic acid
CAS NO.:552-63-6
Empirical Formula: C9H10O3
Molecular Weight: 166.18
MDL number: MFCD00004255
EINECS: 209-020-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB45.60 | In Stock |
|
| 25g | RMB80.00 | In Stock |
|
| 100g | RMB296.00 | In Stock |
|
| 500g | RMB1241.60 | In Stock |
|
| 1000g | RMB2366.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118 °C(lit.) |
| Boiling point: | 322.5±30.0 °C(Predicted) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| form | Solid |
| pka | pKa 3.38(H2O
t = 25
c = 0.03–0.001) (Uncertain) |
| color | White to Off-White |
| Water Solubility | Soluble in water (20 g/L) at 20°C, ethanol, ether, alcohol, and methanol (0.1 g/ml). |
| Merck | 14,9779 |
| BRN | 2209199 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChIKey | JACRWUWPXAESPB-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(CO)C(=O)O |
| LogP | 0.280 (est) |
| EPA Substance Registry System | Tropic acid (552-63-6) |
Description and Uses
Tropic Acid (Ipratropium EP Impurity C) is a benzoic acid derivative and thus carries anti-fungal properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | CY8535000 |
| TSCA | TSCA listed |
| HS Code | 2918195000 |
| Storage Class | 11 - Combustible Solids |




![8-Isopropyl-8-azabicyclo[3.2.1]Octan-3-ol](https://img.chemicalbook.com/CAS/20200515/GIF/259092-15-4.gif)

![(3-endo)-8-(1-Methylethyl)-8-azabicyclo[3.2.1]octan-3-ol](https://img.chemicalbook.com/CAS/GIF/3423-25-4.gif)
