BD0709032
3-Fluoro-4-nitrobenzaldehyde , 95% , 160538-51-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB105.60 | In Stock |
|
| 5g | RMB396.80 | In Stock |
|
| 10g | RMB732.80 | In Stock |
|
| 25g | RMB1478.40 | In Stock |
|
| 100g | RMB4224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-58 |
| Boiling point: | 312℃ |
| Density | 1.443 |
| Flash point: | 143℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | Light yellow to Amber |
| InChI | InChI=1S/C7H4FNO3/c8-6-3-5(4-10)1-2-7(6)9(11)12/h1-4H |
| InChIKey | BWUIGISQVCIQBT-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C([N+]([O-])=O)C(F)=C1 |
Description and Uses
3-fluoro-4-nitrobenzaldehyde is resistant to oxidation by acids and bases and can be used for the synthesis of cytomegalovirus (CMV) inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2913000090 |
