PRODUCT Properties
| Boiling point: | 213.7±13.0 °C(Predicted) |
| Density | 1.176±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 0.16±0.23(Predicted) |
| form | crystalline solid |
| color | Faint orange/light beige |
| InChI | InChI=1S/C6H6N2O/c1-5-7-3-2-6(4-9)8-5/h2-4H,1H3 |
| InChIKey | BXHGNAADUUXBKK-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC(C=O)=N1 |
Description and Uses
2-Methylpyrimidine-4-carboxaldehyde is commonly used as an intermediate in the synthesis of specialized pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933599590 |







