BD0710932
Methyl 2-amino-5-bromopyridine-3-carboxylate , 95% , 50735-34-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB51.20 | In Stock |
|
| 10g | RMB92.80 | In Stock |
|
| 25g | RMB175.20 | In Stock |
|
| 100g | RMB613.60 | In Stock |
|
| 500g | RMB2771.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-146°C |
| Boiling point: | 275.2±35.0 °C(Predicted) |
| Density | 1.662±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.45±0.49(Predicted) |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C7H7BrN2O2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,1H3,(H2,9,10) |
| InChIKey | POWKBBOOIZBIRZ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1C(OC)=O |
Description and Uses
Methyl 2-Amino-5-bromonicotinate is a chemical reagent used in the synthesis of pharmaceutical agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
