PRODUCT Properties
| Melting point: | 140°C |
| Boiling point: | 274.61°C (rough estimate) |
| Density | 1.2804 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 5.60±0.10(Predicted) |
| Appearance | Brown to black Solid |
| InChI | 1S/C7H8N2O2.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3H,8-9H2,(H,10,11);2*1H |
| InChIKey | LAVHFNVUGYKNGS-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Nc1ccc(c(N)c1)C(O)=O |
| CAS DataBase Reference | 611-03-0 |
Description and Uses
2,4-Diaminobenzoic Acid is a reagent used in the optimization of quinazolinones acting as anti-tubercular agents. Also used in the preparation of DNA Polymerase III inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341 |
| Precautionary statements | P501-P202-P201-P264-P280-P308+P313-P337+P313-P305+P351+P338-P302+P352-P332+P313-P362-P405 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |








