BD0717053
Fmoc-D-Dab(Boc)-OH , 95% , 114360-56-4
CAS NO.：114360-56-4
Empirical Formula: C24H28N2O6
Molecular Weight: 440.49
MDL number: MFCD02094099
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB55.20 | In Stock |
|
| 250mg | RMB74.40 | In Stock |
|
| 1g | RMB178.40 | In Stock |
|
| 5g | RMB760.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 670.9±55.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.79±0.10(Predicted) |
| form | Powder |
| color | White |
| InChIKey | LIWKOFAHRLBNMG-HXUWFJFHSA-N |
| SMILES | C(O)(=O)[C@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CCNC(OC(C)(C)C)=O |
Description and Uses
Fmoc-D-Dab(Boc)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize peptides with antibacterial activity[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 29215900 |
